CAS 858096-68-1 is the registry number for 4-[(tert-Butyldimethylsilyl)oxy]-2,6-dimethylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]boronic acid (CAS 858096-68-1) is a chemical compound with the molecular formula C14H25BO3Si and a molecular weight of 280.24 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]boronic acid. InChIKey: SIHMKALMXIRIEV-UHFFFAOYSA-N.
| Molecular formula | C14H25BO3Si |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]boronic acid |
| InChIKey | SIHMKALMXIRIEV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)O[Si](C)(C)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)