Products 2377608-74-5

CAS 2377608-74-5 is the registry number for 5-(Benzyloxy)-2-chloro-4-(trifluoromethyl)phenylboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

[2-chloro-5-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 2377608-74-5) is a chemical compound with the molecular formula C14H11BClF3O3 and a molecular weight of 330.49 g/mol. IUPAC name: [2-chloro-5-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: GHLBGYCIHJSKON-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BClF3O3
Molecular weight330.49 g/mol
IUPAC name[2-chloro-5-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid
InChIKeyGHLBGYCIHJSKON-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)C(F)(F)F)OCC2=CC=CC=C2)(O)O

Computed by PubChem (NCBI)