CAS 871126-25-9 is the registry number for 3-((2'-Chloro-5'-(trifluoromethyl)phenoxy)methyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-[[2-chloro-5-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid (CAS 871126-25-9) is a chemical compound with the molecular formula C14H11BClF3O3 and a molecular weight of 330.49 g/mol. IUPAC name: [3-[[2-chloro-5-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid. InChIKey: IRBNKOHBJCGIFU-UHFFFAOYSA-N.
| Molecular formula | C14H11BClF3O3 |
|---|---|
| Molecular weight | 330.49 g/mol |
| IUPAC name | [3-[[2-chloro-5-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid |
| InChIKey | IRBNKOHBJCGIFU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=C(C=CC(=C2)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)