Products 2377608-93-8

CAS 2377608-93-8 appears in our catalog under these names: [2,6-Difluoro-4-(oxan-4-yloxy)phenyl]boronic acid, 96%, (2,6-Difluoro-4-(oxan-4-yloxy)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

[2,6-difluoro-4-(oxan-4-yloxy)phenyl]boronic acid (CAS 2377608-93-8) is a chemical compound with the molecular formula C11H13BF2O4 and a molecular weight of 258.03 g/mol. IUPAC name: [2,6-difluoro-4-(oxan-4-yloxy)phenyl]boronic acid. InChIKey: KZZBQXPFYMQAOY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BF2O4
Molecular weight258.03 g/mol
IUPAC name[2,6-difluoro-4-(oxan-4-yloxy)phenyl]boronic acid
InChIKeyKZZBQXPFYMQAOY-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1F)OC2CCOCC2)F)(O)O

Computed by PubChem (NCBI)