Products 2377610-10-9

CAS 2377610-10-9 is the registry number for 4-(tert-Butoxycarbonyl)-2,6-difluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

[2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid (CAS 2377610-10-9) is a chemical compound with the molecular formula C11H13BF2O4 and a molecular weight of 258.03 g/mol. IUPAC name: [2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid. InChIKey: WCXDDLZEFHIJBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BF2O4
Molecular weight258.03 g/mol
IUPAC name[2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid
InChIKeyWCXDDLZEFHIJBE-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1F)C(=O)OC(C)(C)C)F)(O)O

Computed by PubChem (NCBI)