CAS 2377609-16-8 appears in our catalog under these names: 5-Bromo-1-methylpyrazole-4-boronic acid pinacol ester, 98%, 5-Bromo-1-methylpyrazole-4-boronic acid pinacol ester, 97%, 97%, 5-Bromo-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
5-bromo-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2377609-16-8) is a chemical compound with the molecular formula C10H16BBrN2O2 and a molecular weight of 286.96 g/mol. IUPAC name: 5-bromo-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: JXLZGAPSMICROL-UHFFFAOYSA-N.
| Molecular formula | C10H16BBrN2O2 |
|---|---|
| Molecular weight | 286.96 g/mol |
| IUPAC name | 5-bromo-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | JXLZGAPSMICROL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2)C)Br |
Computed by PubChem (NCBI)