CAS 2377610-33-6 is the registry number for 4-Bromo-1-methyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2377610-33-6) is a chemical compound with the molecular formula C10H16BBrN2O2 and a molecular weight of 286.96 g/mol. IUPAC name: 4-bromo-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: TZXZDCMPMKGOPJ-UHFFFAOYSA-N.
| Molecular formula | C10H16BBrN2O2 |
|---|---|
| Molecular weight | 286.96 g/mol |
| IUPAC name | 4-bromo-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | TZXZDCMPMKGOPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2Br)C |
Computed by PubChem (NCBI)