CAS 2377610-55-2 is the registry number for N-Methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride (CAS 2377610-55-2) is a chemical compound with the molecular formula C13H21BClNO2 and a molecular weight of 269.58 g/mol. IUPAC name: N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride. InChIKey: GTQZAGFJUBSDEJ-UHFFFAOYSA-N.
| Molecular formula | C13H21BClNO2 |
|---|---|
| Molecular weight | 269.58 g/mol |
| IUPAC name | N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
| InChIKey | GTQZAGFJUBSDEJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NC.Cl |
Computed by PubChem (NCBI)