Products 2377610-94-9

CAS 2377610-94-9 is the registry number for Indole-2,3-diboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 2377610-94-9) is a chemical compound with the molecular formula C20H29B2NO4 and a molecular weight of 369.1 g/mol. IUPAC name: 2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: UUUUNJHEYZLWGT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H29B2NO4
Molecular weight369.1 g/mol
IUPAC name2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
InChIKeyUUUUNJHEYZLWGT-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=C(NC3=CC=CC=C23)B4OC(C(O4)(C)C)(C)C

Computed by PubChem (NCBI)