CAS 919119-72-5 appears in our catalog under these names: 1H-Indole-2,7-diboronic acid, pinacol ester, 98%, 1H-Indole, 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 98%, 98%, 2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 919119-72-5) is a chemical compound with the molecular formula C20H29B2NO4 and a molecular weight of 369.1 g/mol. IUPAC name: 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: PVELYJHNTSSSOF-UHFFFAOYSA-N.
| Molecular formula | C20H29B2NO4 |
|---|---|
| Molecular weight | 369.1 g/mol |
| IUPAC name | 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | PVELYJHNTSSSOF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(N3)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)