CAS 2377901-92-1 is the registry number for (1,3-Dimethyl-1H-indazol-6-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dimethylindazol-6-yl)methanamine;hydrochloride (CAS 2377901-92-1) is a chemical compound with the molecular formula C10H14ClN3 and a molecular weight of 211.69 g/mol. IUPAC name: (1,3-dimethylindazol-6-yl)methanamine;hydrochloride. InChIKey: DXTFXZLAKDGLCG-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3 |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | (1,3-dimethylindazol-6-yl)methanamine;hydrochloride |
| InChIKey | DXTFXZLAKDGLCG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)CN)C.Cl |
Computed by PubChem (NCBI)