CAS 2377920-27-7 is the registry number for 2-(2-Bromo-4-nitrophenoxy)-1-(morpholin-4-yl)ethanone, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-bromo-4-nitrophenoxy)-1-morpholin-4-ylethanone (CAS 2377920-27-7) is a chemical compound with the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)-1-morpholin-4-ylethanone. InChIKey: VXWBVIDEPHOWJJ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O5 |
|---|---|
| Molecular weight | 345.15 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)-1-morpholin-4-ylethanone |
| InChIKey | VXWBVIDEPHOWJJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)COC2=C(C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)