CAS 5502-60-3 is the registry number for 2,2'–({2–((4–Bromophenyl)amino)–2–oxoethyl}imino)diacetic acid. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
2-[[2-(4-bromoanilino)-2-oxoethyl]-(carboxymethyl)amino]acetic acid (CAS 5502-60-3) is a chemical compound with the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. IUPAC name: 2-[[2-(4-bromoanilino)-2-oxoethyl]-(carboxymethyl)amino]acetic acid. InChIKey: PDCSCUOOLRQXQZ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O5 |
|---|---|
| Molecular weight | 345.15 g/mol |
| IUPAC name | 2-[[2-(4-bromoanilino)-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
| InChIKey | PDCSCUOOLRQXQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CN(CC(=O)O)CC(=O)O)Br |
Computed by PubChem (NCBI)