CAS 2378039-23-5 is the registry number for PY109. Offered by: MedChemExpress. Available pack sizes: Get quote.
1H-indol-3-yl-[6-(trifluoromethyl)-2-pyridinyl]methanone (CAS 2378039-23-5) is a chemical compound with the molecular formula C15H9F3N2O and a molecular weight of 290.24 g/mol. IUPAC name: 1H-indol-3-yl-[6-(trifluoromethyl)-2-pyridinyl]methanone. InChIKey: LANJLFOCGPBZLQ-UHFFFAOYSA-N.
| Molecular formula | C15H9F3N2O |
|---|---|
| Molecular weight | 290.24 g/mol |
| IUPAC name | 1H-indol-3-yl-[6-(trifluoromethyl)-2-pyridinyl]methanone |
| InChIKey | LANJLFOCGPBZLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C3=NC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)