CAS 356580-92-2 is the registry number for 8-(5-(trifluoromethyl)-2-pyridyloxy)quinoline. Offered by: Biosynth. Available pack sizes: 250mg.
8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline (CAS 356580-92-2) is a chemical compound with the molecular formula C15H9F3N2O and a molecular weight of 290.24 g/mol. IUPAC name: 8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline. InChIKey: TYGUHONUJWAOAI-UHFFFAOYSA-N.
| Molecular formula | C15H9F3N2O |
|---|---|
| Molecular weight | 290.24 g/mol |
| IUPAC name | 8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline |
| InChIKey | TYGUHONUJWAOAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC3=NC=C(C=C3)C(F)(F)F)N=CC=C2 |
Computed by PubChem (NCBI)