CAS 2378052-12-9 is the registry number for (S)-1-(6-(4-Methylthiazol-5-yl)pyridin-3-yl)ethan-1-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(1S)-1-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]ethanamine;hydrochloride (CAS 2378052-12-9) is a chemical compound with the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. IUPAC name: (1S)-1-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]ethanamine;hydrochloride. InChIKey: HEQGEGOZAWBFCP-FJXQXJEOSA-N.
| Molecular formula | C11H14ClN3S |
|---|---|
| Molecular weight | 255.77 g/mol |
| IUPAC name | (1S)-1-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]ethanamine;hydrochloride |
| InChIKey | HEQGEGOZAWBFCP-FJXQXJEOSA-N |
| SMILES | CC1=C(SC=N1)C2=NC=C(C=C2)[C@H](C)N.Cl |
Computed by PubChem (NCBI)