CAS 87691-88-1 appears in our catalog under these names: 3-Piperazin-1-yl-1,2-benzisothiazole Hydrochloride, Lurasidone Impurity 9, Ziprasidone EP Impurity A HCl, 3-Piperazinyl-1,2-benzisothiazole hydrochloride, 3-Piperazinobenzisothiazole hydrochloride, 95%, 95%. Offered by: Mikromol, Chemat Brand, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, on request, 50g, 100g, 1g, 5g, 10g.
3-piperazin-1-yl-1,2-benzothiazole;hydrochloride (CAS 87691-88-1) is a chemical compound with the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. IUPAC name: 3-piperazin-1-yl-1,2-benzothiazole;hydrochloride. InChIKey: DOQLJTKEUIJSKK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3S |
|---|---|
| Molecular weight | 255.77 g/mol |
| IUPAC name | 3-piperazin-1-yl-1,2-benzothiazole;hydrochloride |
| InChIKey | DOQLJTKEUIJSKK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NSC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)