Products 2378381-06-5
CAS 2378381-06-5 is the registry number for Tarvicopan. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[[7-[2-(aminomethyl)-4-pyridinyl]-2-methyl-1-benzofuran-5-yl]methoxy]phenyl]acetic acid (CAS 2378381-06-5) is a chemical compound with the molecular formula C24H22N2O4 and a molecular weight of 402.4 g/mol. IUPAC name: 2-[2-[[7-[2-(aminomethyl)-4-pyridinyl]-2-methyl-1-benzofuran-5-yl]methoxy]phenyl]acetic acid. InChIKey: ZUWLRQGSPOOCNF-UHFFFAOYSA-N.
| Molecular formula | C24H22N2O4 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 2-[2-[[7-[2-(aminomethyl)-4-pyridinyl]-2-methyl-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| InChIKey | ZUWLRQGSPOOCNF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C(=CC(=C2)COC3=CC=CC=C3CC(=O)O)C4=CC(=NC=C4)CN |
Computed by PubChem (NCBI)