Products 23790-39-8
CAS 23790-39-8 appears in our catalog under these names: 2,6–Di–tert–butyl–4–methylcyclohexanone (mixture of isomers), 2,6-Di-tert-butyl-4-methylcyclohexanone (mixture of isomers), >95.0%(GC), 2,6-Di-tert-butyl-4-methylcyclohexanone 98%, 2,6-Di-tert-butyl-4-methylcyclohexanone, 98%, 98%, 2,6-Di-tert-butyl-4-methylcyclohexan-1-one, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1ml, 5ml, 250mg, 1g, 5g, 25g.
2,6-ditert-butyl-4-methylcyclohexan-1-one (CAS 23790-39-8) is a chemical compound with the molecular formula C15H28O and a molecular weight of 224.38 g/mol. IUPAC name: 2,6-ditert-butyl-4-methylcyclohexan-1-one. InChIKey: LDPDMUPXRDWOPE-UHFFFAOYSA-N.
| Molecular formula | C15H28O |
|---|---|
| Molecular weight | 224.38 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-methylcyclohexan-1-one |
| InChIKey | LDPDMUPXRDWOPE-UHFFFAOYSA-N |
| SMILES | CC1CC(C(=O)C(C1)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)