Products 51317-08-9
CAS 51317-08-9 appears in our catalog under these names: β–Eudesmol, Eudesmol, β-Eudesmol, 98.00% ,, 98.00% ,, β-Eudesmol, 98%. Offered by: GLPBio, TargetMol, Chemat. Available pack sizes: 20mg, 2mg, 10mg, 50mg.
2-[(2R,4aR,8R,8aS)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propan-2-ol (CAS 51317-08-9) is a chemical compound with the molecular formula C15H28O and a molecular weight of 224.38 g/mol. IUPAC name: 2-[(2R,4aR,8R,8aS)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propan-2-ol. InChIKey: YJHVMPKSUPGGPZ-GUIRCDHDSA-N.
| Molecular formula | C15H28O |
|---|---|
| Molecular weight | 224.38 g/mol |
| IUPAC name | 2-[(2R,4aR,8R,8aS)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propan-2-ol |
| InChIKey | YJHVMPKSUPGGPZ-GUIRCDHDSA-N |
| SMILES | C[C@@H]1CCC[C@]2([C@H]1C[C@@H](CC2)C(C)(C)O)C |
Computed by PubChem (NCBI)