Products 2379311-49-4
CAS 2379311-49-4 is the registry number for Methyl 4-fluoro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-fluoro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2379311-49-4) is a chemical compound with the molecular formula C14H18BFO5 and a molecular weight of 296.10 g/mol. IUPAC name: methyl 4-fluoro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: QMIFDKVUUGAGHQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO5 |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | methyl 4-fluoro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | QMIFDKVUUGAGHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)O)C(=O)OC |
Computed by PubChem (NCBI)