CAS 2377608-63-2 is the registry number for 2-Fluoro-3-methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377608-63-2) is a chemical compound with the molecular formula C14H18BFO5 and a molecular weight of 296.10 g/mol. IUPAC name: 2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: RMFBIUSYGNRHLI-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO5 |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | RMFBIUSYGNRHLI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)C(=O)O)F)OC |
Computed by PubChem (NCBI)