CAS 2787520-58-3 is the registry number for 4-Fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2787520-58-3) is a chemical compound with the molecular formula C14H18BFO5 and a molecular weight of 296.10 g/mol. IUPAC name: 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: FSFCZWFICSVQPQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO5 |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | FSFCZWFICSVQPQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OC)C(=O)O |
Computed by PubChem (NCBI)