CAS 2379321-44-3 appears in our catalog under these names: 2-Bromo-6-fluoro-3-(methoxymethoxy)benzaldehyde, 2-Bromo-6-fluoro-3-(methoxymethoxy)benzaldehyde, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
2-bromo-6-fluoro-3-(methoxymethoxy)benzaldehyde (CAS 2379321-44-3) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: 2-bromo-6-fluoro-3-(methoxymethoxy)benzaldehyde. InChIKey: FVPBVQRQJQZHIM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO3 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-(methoxymethoxy)benzaldehyde |
| InChIKey | FVPBVQRQJQZHIM-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)F)C=O)Br |
Computed by PubChem (NCBI)