CAS 2484889-08-7 appears in our catalog under these names: 5-Bromo-2-fluoro-4-methoxy-3-methylbenzoic acid, 95%, 5-Bromo-2-fluoro-4-methoxy-3-methylbenzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
5-bromo-2-fluoro-4-methoxy-3-methylbenzoic acid (CAS 2484889-08-7) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methoxy-3-methylbenzoic acid. InChIKey: PXYXSJIJFMMDNP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO3 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methoxy-3-methylbenzoic acid |
| InChIKey | PXYXSJIJFMMDNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1OC)Br)C(=O)O)F |
Computed by PubChem (NCBI)