Products 2379321-78-3
CAS 2379321-78-3 is the registry number for (1-(4-Chloro-2-fluorophenyl)-1h-pyrazol-4-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
[1-(4-chloro-2-fluorophenyl)pyrazol-4-yl]methanol (CAS 2379321-78-3) is a chemical compound with the molecular formula C10H8ClFN2O and a molecular weight of 226.63 g/mol. IUPAC name: [1-(4-chloro-2-fluorophenyl)pyrazol-4-yl]methanol. InChIKey: GVIFPXRDBOYSES-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2O |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | [1-(4-chloro-2-fluorophenyl)pyrazol-4-yl]methanol |
| InChIKey | GVIFPXRDBOYSES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)N2C=C(C=N2)CO |
Computed by PubChem (NCBI)