CAS 867315-05-7 appears in our catalog under these names: 5-(Chloromethyl)-3-((4-fluorophenyl)methyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-((4-fluorophenyl)methyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(chloromethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole (CAS 867315-05-7) is a chemical compound with the molecular formula C10H8ClFN2O and a molecular weight of 226.63 g/mol. IUPAC name: 5-(chloromethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole. InChIKey: URRYAPDXDYWJLI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2O |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | 5-(chloromethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole |
| InChIKey | URRYAPDXDYWJLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NOC(=N2)CCl)F |
Computed by PubChem (NCBI)