CAS 2379322-14-0 appears in our catalog under these names: 4-Bromo-n-cyclohexyl-2,5-difluorobenzamide, 95%, 4-Bromo-N-cyclohexyl-2,5-difluorobenzamide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-bromo-N-cyclohexyl-2,5-difluorobenzamide (CAS 2379322-14-0) is a chemical compound with the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. IUPAC name: 4-bromo-N-cyclohexyl-2,5-difluorobenzamide. InChIKey: LMVXVIQYDKJBAY-UHFFFAOYSA-N.
| Molecular formula | C13H14BrF2NO |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | 4-bromo-N-cyclohexyl-2,5-difluorobenzamide |
| InChIKey | LMVXVIQYDKJBAY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)