CAS 497061-26-4 is the registry number for N-(2-bromo-4,6-difluorophenyl)cyclohexylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-bromo-4,6-difluorophenyl)cyclohexanecarboxamide (CAS 497061-26-4) is a chemical compound with the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. IUPAC name: N-(2-bromo-4,6-difluorophenyl)cyclohexanecarboxamide. InChIKey: YRINQDPTGFGPQO-UHFFFAOYSA-N.
| Molecular formula | C13H14BrF2NO |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | N-(2-bromo-4,6-difluorophenyl)cyclohexanecarboxamide |
| InChIKey | YRINQDPTGFGPQO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=C(C=C(C=C2Br)F)F |
Computed by PubChem (NCBI)