CAS 2379322-54-8 is the registry number for (((4-Bromo-2-fluoro-1,3-phenylene)bis(oxy))bis(methylene))dibenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-bromo-3-fluoro-2,4-bis(phenylmethoxy)benzene (CAS 2379322-54-8) is a chemical compound with the molecular formula C20H16BrFO2 and a molecular weight of 387.2 g/mol. IUPAC name: 1-bromo-3-fluoro-2,4-bis(phenylmethoxy)benzene. InChIKey: ZDAAENNXBCTNBK-UHFFFAOYSA-N.
| Molecular formula | C20H16BrFO2 |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2,4-bis(phenylmethoxy)benzene |
| InChIKey | ZDAAENNXBCTNBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)