CAS 2901084-75-9 is the registry number for (3-(benzyloxy)-2-bromo-6-fluorophenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-6-fluoro-3-phenylmethoxyphenyl)-phenylmethanol (CAS 2901084-75-9) is a chemical compound with the molecular formula C20H16BrFO2 and a molecular weight of 387.2 g/mol. IUPAC name: (2-bromo-6-fluoro-3-phenylmethoxyphenyl)-phenylmethanol. InChIKey: UXLWKBXXZNIDIQ-UHFFFAOYSA-N.
| Molecular formula | C20H16BrFO2 |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-phenylmethoxyphenyl)-phenylmethanol |
| InChIKey | UXLWKBXXZNIDIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)C(C3=CC=CC=C3)O)Br |
Computed by PubChem (NCBI)