Products 2381631-51-0
CAS 2381631-51-0 is the registry number for (R)-2-(4-(tert-butoxycarbonyl)morpholin-2-yl)benzoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]benzoic acid (CAS 2381631-51-0) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: 2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]benzoic acid. InChIKey: OLAMNZMCLBCLKB-ZDUSSCGKSA-N.
| Molecular formula | C16H21NO5 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]benzoic acid |
| InChIKey | OLAMNZMCLBCLKB-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)