CAS 2381715-94-0 is the registry number for Argatroban Impurity 72. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-amino-N-nitro-2-oxopiperidine-1-carboximidamide (CAS 2381715-94-0) is a chemical compound with the molecular formula C6H11N5O3 and a molecular weight of 201.18 g/mol. IUPAC name: (3S)-3-amino-N-nitro-2-oxopiperidine-1-carboximidamide. InChIKey: RKVSBSRPPGRNLW-BYPYZUCNSA-N.
| Molecular formula | C6H11N5O3 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | (3S)-3-amino-N-nitro-2-oxopiperidine-1-carboximidamide |
| InChIKey | RKVSBSRPPGRNLW-BYPYZUCNSA-N |
| SMILES | C1C[C@@H](C(=O)N(C1)C(=N)N[N+](=O)[O-])N |
Computed by PubChem (NCBI)