CAS 38184-47-3 appears in our catalog under these names: 3,5-DIMETHYLPYRAZOLE-1-CARBOXAMIDINE &, 3,5-Dimethylpyrazole-1-carboxamidine nitrate, 97%, 97%, 3,5-Dimethylpyrazole-1-carboxamidine nitrate, 97%,RG. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25G, 1g, 5g, 100g.
3,5-dimethylpyrazole-1-carboximidamide;nitric acid (CAS 38184-47-3) is a chemical compound with the molecular formula C6H11N5O3 and a molecular weight of 201.18 g/mol. IUPAC name: 3,5-dimethylpyrazole-1-carboximidamide;nitric acid. InChIKey: AGYXIUAGBLMBGV-UHFFFAOYSA-N.
| Molecular formula | C6H11N5O3 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 3,5-dimethylpyrazole-1-carboximidamide;nitric acid |
| InChIKey | AGYXIUAGBLMBGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=N)N)C.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)