CAS 23821-63-8 appears in our catalog under these names: 2-(2-Phenyl-4-(p-tolyl)thiazol-5-yl)acetic acid, 97%, 2-(4-(4-Methylphenyl)-2-phenyl-1,3-thiazol-5-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[4-(4-methylphenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid (CAS 23821-63-8) is a chemical compound with the molecular formula C18H15NO2S and a molecular weight of 309.4 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid. InChIKey: SVHRHIAVTBGMID-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2S |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid |
| InChIKey | SVHRHIAVTBGMID-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CC=C3)CC(=O)O |
Computed by PubChem (NCBI)