CAS 91076-97-0 is the registry number for Methyl 5-((1,1'-biphenyl)-4-yl)-3-aminothiophene-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate (CAS 91076-97-0) is a chemical compound with the molecular formula C18H15NO2S and a molecular weight of 309.4 g/mol. IUPAC name: methyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate. InChIKey: JGPQOCFURASLCN-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2S |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | methyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate |
| InChIKey | JGPQOCFURASLCN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)