CAS 2382412-23-7 is the registry number for (3S,5S)-1-Benzyl-5-fluoropiperidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5S)-1-benzyl-5-fluoropiperidin-3-amine (CAS 2382412-23-7) is a chemical compound with the molecular formula C12H17FN2 and a molecular weight of 208.27 g/mol. IUPAC name: (3S,5S)-1-benzyl-5-fluoropiperidin-3-amine. InChIKey: GDKWWZUZIWWDTA-RYUDHWBXSA-N.
| Molecular formula | C12H17FN2 |
|---|---|
| Molecular weight | 208.27 g/mol |
| IUPAC name | (3S,5S)-1-benzyl-5-fluoropiperidin-3-amine |
| InChIKey | GDKWWZUZIWWDTA-RYUDHWBXSA-N |
| SMILES | C1[C@@H](CN(C[C@H]1F)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)