CAS 422270-29-9 appears in our catalog under these names: (R)-1-(4-Fluorobenzyl)-3-methylpiperazine, 95%, (R)–1–(4–fluorobenzyl)–3–methylpiperazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(3R)-1-[(4-fluorophenyl)methyl]-3-methylpiperazine (CAS 422270-29-9) is a chemical compound with the molecular formula C12H17FN2 and a molecular weight of 208.27 g/mol. IUPAC name: (3R)-1-[(4-fluorophenyl)methyl]-3-methylpiperazine. InChIKey: NPIPCQHHNIFPQW-SNVBAGLBSA-N.
| Molecular formula | C12H17FN2 |
|---|---|
| Molecular weight | 208.27 g/mol |
| IUPAC name | (3R)-1-[(4-fluorophenyl)methyl]-3-methylpiperazine |
| InChIKey | NPIPCQHHNIFPQW-SNVBAGLBSA-N |
| SMILES | C[C@@H]1CN(CCN1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)