CAS 2382518-71-8 is the registry number for tert-butyl (4S)-4-cyanoazepane-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (4S)-4-cyanoazepane-1-carboxylate (CAS 2382518-71-8) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: tert-butyl (4S)-4-cyanoazepane-1-carboxylate. InChIKey: GWIFZKJNRMQRJU-JTQLQIEISA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | tert-butyl (4S)-4-cyanoazepane-1-carboxylate |
| InChIKey | GWIFZKJNRMQRJU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CC1)C#N |
Computed by PubChem (NCBI)