CAS 2382719-63-1 is the registry number for Rel-(1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Cis-(1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid (CAS 2382719-63-1) is a chemical compound with the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. IUPAC name: cis-(1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: VJJABIMANCDOSQ-NKWVEPMBSA-N.
| Molecular formula | C10H17BO4 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | cis-(1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid |
| InChIKey | VJJABIMANCDOSQ-NKWVEPMBSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@@H]2C[C@@H]2C(=O)O |
Computed by PubChem (NCBI)