CAS 1268246-89-4 is the registry number for (E)-2-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acrylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid (CAS 1268246-89-4) is a chemical compound with the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. IUPAC name: (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid. InChIKey: VGCPUIWCLXVSHQ-VOTSOKGWSA-N.
| Molecular formula | C10H17BO4 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid |
| InChIKey | VGCPUIWCLXVSHQ-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/C(=O)O |
Computed by PubChem (NCBI)