CAS 2769113-99-5 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid (CAS 2769113-99-5) is a chemical compound with the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: VJJABIMANCDOSQ-UHFFFAOYSA-N.
| Molecular formula | C10H17BO4 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylic acid |
| InChIKey | VJJABIMANCDOSQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC2C(=O)O |
Computed by PubChem (NCBI)