Products 2383602-45-5
CAS 2383602-45-5 is the registry number for 2-Bromo-6-fluoro-3-formylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-6-fluoro-3-formylbenzoic acid (CAS 2383602-45-5) is a chemical compound with the molecular formula C8H4BrFO3 and a molecular weight of 247.02 g/mol. IUPAC name: 2-bromo-6-fluoro-3-formylbenzoic acid. InChIKey: HQHYRLIOZXFCKA-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO3 |
|---|---|
| Molecular weight | 247.02 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-formylbenzoic acid |
| InChIKey | HQHYRLIOZXFCKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Br)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-6-fluoro-3-formylbenZoic acid