Products 2383712-87-4
CAS 2383712-87-4 is the registry number for tert-Butyl 3-(1-fluoro-2-oxoethylidene)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(1-fluoro-2-oxoethylidene)azetidine-1-carboxylate (CAS 2383712-87-4) is a chemical compound with the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. IUPAC name: tert-butyl 3-(1-fluoro-2-oxoethylidene)azetidine-1-carboxylate. InChIKey: NTLQMPZHEVFPLP-UHFFFAOYSA-N.
| Molecular formula | C10H14FNO3 |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | tert-butyl 3-(1-fluoro-2-oxoethylidene)azetidine-1-carboxylate |
| InChIKey | NTLQMPZHEVFPLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C(C=O)F)C1 |
Computed by PubChem (NCBI)