CAS 2454498-75-8 is the registry number for Ethyl rel-(2S,7aR)-2-fluoro-5-oxotetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,8R)-2-fluoro-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (CAS 2454498-75-8) is a chemical compound with the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. IUPAC name: ethyl (2S,8R)-2-fluoro-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate. InChIKey: AMVVXLSSVZDGEQ-OIBJUYFYSA-N.
| Molecular formula | C10H14FNO3 |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | ethyl (2S,8R)-2-fluoro-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| InChIKey | AMVVXLSSVZDGEQ-OIBJUYFYSA-N |
| SMILES | CCOC(=O)[C@]12CCC(=O)N1C[C@H](C2)F |
Computed by PubChem (NCBI)