Products 2383714-85-8
CAS 2383714-85-8 is the registry number for 5-AMINO-4-(TERT-BUTOXYCARBONYL)THIOPHENE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
5-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid (CAS 2383714-85-8) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 5-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid. InChIKey: UUGWPRQUJQCXEN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 5-amino-4-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid |
| InChIKey | UUGWPRQUJQCXEN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC(=C1)C(=O)O)N |
Computed by PubChem (NCBI)