Products 2383785-89-3

CAS 2383785-89-3 is the registry number for 6-Amino-2,5-dimethylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-amino-2,5-dimethylpyridine-3-carboxylic acid (CAS 2383785-89-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 6-amino-2,5-dimethylpyridine-3-carboxylic acid. InChIKey: JHVVCULPUSAGLU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name6-amino-2,5-dimethylpyridine-3-carboxylic acid
InChIKeyJHVVCULPUSAGLU-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1N)C)C(=O)O

Computed by PubChem (NCBI)