Products 2383903-89-5
CAS 2383903-89-5 is the registry number for tert-Butyl 6-hydroxy-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
Tert-butyl 6-hydroxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 2383903-89-5) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl 6-hydroxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: MRUMYIVAIOMKBK-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | MRUMYIVAIOMKBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=C(C=C3)O)NC2=O |
Computed by PubChem (NCBI)