CAS 238418-67-2 is the registry number for DL-erythro-4-Fluoroglutamine. Offered by: TRC. Available pack sizes: 100mg.
(2R,4S)-5-amino-2-azaniumyl-4-fluoro-5-oxopentanoate (CAS 238418-67-2) is a chemical compound with the molecular formula C5H9FN2O3 and a molecular weight of 164.14 g/mol. IUPAC name: (2R,4S)-5-amino-2-azaniumyl-4-fluoro-5-oxopentanoate. InChIKey: PGEYFCBAWGQSGT-STHAYSLISA-N.
| Molecular formula | C5H9FN2O3 |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | (2R,4S)-5-amino-2-azaniumyl-4-fluoro-5-oxopentanoate |
| InChIKey | PGEYFCBAWGQSGT-STHAYSLISA-N |
| SMILES | C([C@H](C(=O)[O-])[NH3+])[C@@H](C(=O)N)F |
Computed by PubChem (NCBI)