Products 883497-53-8

CAS 883497-53-8 is the registry number for DL-erythro-4-Fluoroisoglutamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-diamino-2-fluoro-5-oxopentanoic acid (CAS 883497-53-8) is a chemical compound with the molecular formula C5H9FN2O3 and a molecular weight of 164.14 g/mol. IUPAC name: 2,5-diamino-2-fluoro-5-oxopentanoic acid. InChIKey: SFRQIQMVUGFBRW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9FN2O3
Molecular weight164.14 g/mol
IUPAC name2,5-diamino-2-fluoro-5-oxopentanoic acid
InChIKeySFRQIQMVUGFBRW-UHFFFAOYSA-N
SMILESC(CC(C(=O)O)(N)F)C(=O)N

Computed by PubChem (NCBI)